| Identification |
| Name: | Butanedioic acid,1-phosphono ester |
| Synonyms: | Butanedioicacid, monoanhydride with phosphoric acid (9CI); Succinic acid, anhydride withH3PO4 (7CI); Succinic acid, monoanhydride with phosphoric acid (8CI); Succinylmonophosphate; Succinyl phosphate |
| CAS: | 3469-79-2 |
| Molecular Formula: | C4H7 O7 P |
| Molecular Weight: | 0 |
| InChI: | InChI=1/C4H4O3.H3O4P/c5-3-1-2-4(6)7-3;1-5(2,3)4/h1-2H2;(H3,1,2,3,4) |
| Molecular Structure: |
 |
| Properties |
| Flash Point: | 122.1°C |
| Boiling Point: | 261°Cat760mmHg |
| Density: | g/cm3 |
| Flash Point: | 122.1°C |
| Safety Data |
| |
 |
