| Identification |
| Name: | 2-fluoroaniline |
| Synonyms: | o-Fluoroaniline; 1-Amino-2-fluorobenzene; 2-fluoro-Benzenamine; 2-fluoro-benzenamin; 1,2-fluorobenzenamine; 2-fluoro-aniline; 2-Fluoro-phenylamine; 1-Amino-2-fluorobenzen |
| CAS: | 348-54-9 |
| EINECS: | 206-478-9 |
| Molecular Formula: | C6H6FN |
| Molecular Weight: | 111.12 |
| InChI: | InChI=1/C6H6FN/c7-5-3-1-2-4-6(5)8/h1-4H,8H2 |
| Molecular Structure: |
 |
| Properties |
| Transport: | UN 2941 |
| Density: | 1.151 |
| Stability: | Stable under normal temperatures and pressures. |
| Refractive index: | 1.54-1.542 |
| Water Solubility: | slightly soluble |
| Solubility: | slightly soluble |
| Appearance: | clear to brown liquid |
| Packinggroup: | III |
| HS Code: | 29214210 |
| Storage Temperature: | Keep away from sources of ignition. Store in a cool, dry place. Store in a tightly closed container. |
| Safety Data |
| Hazard Symbols |
Xi:Irritant
|
| |
 |
