| Identification | |
| Name: | D-Methionine |
| Synonyms: | Methionine,D- (8CI);(R)-Methionine;D-2-Amino-4-(methylthio)butyric acid;(R)-2-Amino-4-(methylmercapto)butyric acid; |
| CAS: | 348-67-4 |
| EINECS: | 206-483-6 |
| Molecular Formula: | C5H11NO2S |
| Molecular Weight: | 149.21 |
| InChI: | InChI=1/C5H11NO2S/c1-9-3-2-4(6)5(7)8/h4H,2-3,6H2,1H3,(H,7,8) |
| Molecular Structure: |  |
| Properties | |
| Density: | 1.206 g/cm3 |
| Stability: | Stable. Incompatible with strong oxidizing agents. |
| Refractive index: | 1.53 |
| Alpha: | -24 o (C=8, 6N HCL) |
| Appearance: | white powder |
| Report: |
Reported in EPA TSCA Inventory. |
| Color: | Minute hexagonal plates from dilute alcohol Colorless or white, lustrous plates or as white, crystalline powder |
| Usage: | One of the 20 common amino acids in humans. Non-essential. |
| Safety Data | |
 |
|
