| Identification | |
| Name: | GTP-14564 |
| Synonyms: | 3-Phenyl-1H-benzofuro(3,2-c)pyrazole; |
| CAS: | 34823-86-4 |
| Molecular Formula: | C15H10N2O |
| Molecular Weight: | 234.25 |
| InChI: | InChI=1/C15H10N2O/c1-2-6-10(7-3-1)13-15-14(17-16-13)11-8-4-5-9-12(11)18-15/h1-9H,(H,16,17) |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 240.7°C |
| Boiling Point: | 459.1°Cat760mmHg |
| Density: | 1.321g/cm3 |
| Refractive index: | 1.738 |
| Biological Activity: | Potent, selective inhibitor of class III receptor tyrosine kinases (IC 50 values are 0.3 μ M for c-Fms, c-Kit, FLT3 and ITD-FLT3 and 1 μ M for PDGFR β ). Displays no selectivity for ERK1, ERK2, EGFR, MEK1, HER2, Src, Abl, PKC, PKA and Akt (IC50 > 10 μ M). Inhibits FL-dependent proliferation in BaF/ITD-FLT3 cells more potently than BaF/wt-FLT3 cells; anti-leukaemic. |
| Flash Point: | 240.7°C |
| Safety Data | |
 |
|
