| Identification |
| Name: | L-Tyrosine, N-benzoyl-,ethyl ester |
| Synonyms: | Tyrosine,N-benzoyl-, ethyl ester, L- (8CI);Benzoyltyrosine ethyl ester;EthylN-benzoyl-L-tyrosinate;Ethyl benzoyltyrosinate;N-Benzoyl-L-tyrosine ethylester;N-Benzoyltyrosine ethyl ester;NSC 75895; |
| CAS: | 3483-82-7 |
| EINECS: | 222-469-2 |
| Molecular Formula: | C18H19NO4 |
| Molecular Weight: | 313.35 |
| InChI: | InChI=1/C18H19NO4/c1-2-23-18(22)16(12-13-8-10-15(20)11-9-13)19-17(21)14-6-4-3-5-7-14/h3-11,16,20H,2,12H2,1H3,(H,19,21) |
| Molecular Structure: |
 |
| Properties |
| Melting Point: | 118-121 ºC |
| Flash Point: | 290.8°C |
| Boiling Point: | 557.3°Cat760mmHg |
| Density: | 1.21g/cm3 |
| Stability: | Stable under normal temperatures and pressures. |
| Refractive index: | -29 ° (C=1, EtOH) |
| Alpha: | -24 º (C=1, ETOH) |
| Appearance: | White to off-white crystals. |
| Flash Point: | 290.8°C |
| Storage Temperature: | −20°C |
| Safety Data |
| |
 |
