| Identification |
| Name: | 1-Propanone,1-(3-chlorophenyl)- |
| Synonyms: | Propiophenone,3'-chloro- (6CI,7CI);1-(3-Chlorophenyl)-1-propanone;3-Chlorophenyl ethylketone;m-Chloropropiophenone; |
| CAS: | 34841-35-5 |
| EINECS: | 252-242-3 |
| Molecular Formula: | C9H9ClO |
| Molecular Weight: | 168.62 |
| InChI: | InChI=1/C9H9ClO/c1-2-9(11)7-4-3-5-8(10)6-7/h3-6H,2H2,1H3 |
| Molecular Structure: |
 |
| Properties |
| Density: | 1.128 g/cm3 |
| Stability: | Stable under normal temperatures and pressures. |
| Refractive index: | 1.525 |
| Solubility: | Insoluble |
| Appearance: | White to grey to yellow crystalline solid |
| Storage Temperature: | Store in a tightly closed container. Store in a cool, dry, well-ventilated area away from incompatible substances. |
| Safety Data |
| Hazard Symbols |
Xi:Irritant
|
| |
 |
