| Identification | |
| Name: | 3-Quinolinecarbonitrile |
| Synonyms: | 3-Cyanoquinoline;NSC 44644 |
| CAS: | 34846-64-5 |
| EINECS: | 252-248-6 |
| Molecular Formula: | C10H6 N2 |
| Molecular Weight: | 154.17 |
| InChI: | InChI=1/C10H6N2/c11-6-8-5-9-3-1-2-4-10(9)12-7-8/h1-5,7H |
| Molecular Structure: |  |
| Properties | |
| Density: | 1.21 g/cm3 |
| Refractive index: | 1.654 |
| Appearance: | white to light yellow crystal powder |
| Specification: |
3-Quinolinecarbonitrile , its cas register number is 34846-64-5. It also can be called Quinoline-3-carbonitrile ; EINECS 252-248-6 ; NSC 44644 . 3-Quinolinecarbonitrile (CAS NO.34846-64-5) is a kind of white to light yellow crystal powder which is harmful by inhalation, in contact with skin and if swallowed. And it is irritating to eyes, respiratory system and skin. |
| Safety Data | |
| Hazard Symbols |
Xn:Harmful
|
 |
|
