| Identification |
| Name: | JX401 |
| Synonyms: | JX401;1-[2-Methoxy-4-(methylthio)benzoyl]-4-benzylpiperidine |
| CAS: | 349087-34-9 |
| Molecular Formula: | C21H25NO2S |
| Molecular Weight: | 0 |
| InChI: | InChI=1/C21H25NO2S/c1-24-20-15-18(25-2)8-9-19(20)21(23)22-12-10-17(11-13-22)14-16-6-4-3-5-7-16/h3-9,15,17H,10-14H2,1-2H3 |
| Molecular Structure: |
![(C21H25NO2S) JX401;1-[2-Methoxy-4-(methylthio)benzoyl]-4-benzylpiperidine](https://img.guidechem.com/structure/349087-34-9.gif) |
| Properties |
| Transport: | UN 3077 9/PG 3 |
| Flash Point: | 278.8°C |
| Boiling Point: | 537.3°C at 760 mmHg |
| Density: | 1.17g/cm3 |
| Refractive index: | 1.611 |
| Biological Activity: | Potent, reversible inhibitor of p38 α that displays no activity on the p38 γ isoform (IC 50 values are 32 nM and > 10 μ M respectively). Inhibits the differentiation of myoblasts to myotubes in mammalian cells in culture. |
| Flash Point: | 278.8°C |
| Safety Data |
| |
 |