| Identification | |
| Name: | 1,4-Benzenedicarboxylicacid, 2-nitro-, 1-methyl ester |
| Synonyms: | 1-Methyl2-nitroterephthalate; 2-Nitroterephthalic acid 1-methyl ester;4-Methoxycarbonyl-3-nitrobenzoic acid; NSC 151109 |
| CAS: | 35092-89-8 |
| EINECS: | 252-360-5 |
| Molecular Formula: | C9H7 N O6 |
| Molecular Weight: | 225.155 |
| InChI: | InChI=1/C9H7NO6/c1-16-9(13)6-3-2-5(8(11)12)4-7(6)10(14)15/h2-4H,1H3,(H,11,12) |
| Molecular Structure: |  |
| Properties | |
| Density: | 1.484 g/cm3 |
| Refractive index: | 1.594 |
| Specification: |
1,4-Benzenedicarboxylicacid, 2-nitro-, 1-methyl ester , its cas register number is 35092-89-8. It also can be called Methyl hydrogen 2-nitroterephthalate . 1,4-Benzenedicarboxylicacid, 2-nitro-, 1-methyl ester (CAS NO.35092-89-8) is irritating to eyes, respiratory system and skin. In case of contact with eyes, rinse immediately with plenty of water and seek medical advice. |
| Safety Data | |
| Hazard Symbols |
Xi: Irritant
|
 |
|
