| Identification | |
| Name: | Acetamide,N-(4-fluorophenyl)- |
| Synonyms: | Acetanilide,4'-fluoro- (6CI,7CI,8CI); 4-Fluoroacetanilide; 4'-Fluoroacetanilide;N-(4-Fluorophenyl)acetamide; N-p-Fluorophenylacetamide; NSC 10349;p-Fluoroacetanilide |
| CAS: | 351-83-7 |
| EINECS: | 206-515-9 |
| Molecular Formula: | C8H8 F N O |
| Molecular Weight: | 153.15 |
| InChI: | InChI=1/C8H8FNO/c1-6(11)10-8-4-2-7(9)3-5-8/h2-5H,1H3,(H,10,11) |
| Molecular Structure: |  |
| Properties | |
| Boiling Point: | 310 |
| Stability: | Stable at room temperature in closed containers under normal storage and handling conditions. |
| Water Solubility: | practically insoluble |
| Solubility: | Water Solubility : practically insoluble |
| Appearance: | Off-white powder. |
| Specification: |
4-Fluoroacetanilide , its CAS NO. is 351-83-7, the synonyms are AI3-52222 ; BRN 2208090 ; EINECS 206-515-9 ; N-(4-Fluorophenyl)acetamide ; N-p-Fluorophenylacetamide ; NSC 10349 ; p-Fluoroacetanilide ; Acetamide, N-(4-fluorophenyl)- (9CI) ; Acetanilide, 4'-fluoro- ; N-(4-Fluorophenyl)acetamide . |
| Storage Temperature: | Store in a tightly closed container. Store in a cool, dry, well-ventilated area away from incompatible substances. |
| Safety Data | |
 |
|
