| Identification |
| Name: | p-Chlorofluorobenzene |
| Synonyms: | 4-FLUOROCHLOROBENZENE; 4-CHLOROFLUOROBENZENE; 1,4-Fluorochlorobenzene; 1-chloro-4-fluoro-benzen; 1-Fluoro-4-chlorobenzene; P-FLUOROCHLOROBENZENE; 4-CHLOROFLUOROBENZENE 99% (GC) |
| CAS: | 352-33-0 |
| EINECS: | 206-521-1 |
| Molecular Formula: | C6H4ClF |
| Molecular Weight: | 130.55 |
| InChI: | InChI=1/C6H4ClF/c7-5-1-3-6(8)4-2-5/h1-4H |
| Molecular Structure: |
 |
| Properties |
| Transport: | UN 1993 |
| Density: | 1.226 |
| Stability: | Stable under normal temperatures and pressures. |
| Refractive index: | 1.494-1.496 |
| Solubility: | Insoluble |
| Appearance: | Clear colourless to light yellow liquid |
| Packinggroup: | III |
| Storage Temperature: | Flammables area |
| Safety Data |
| Hazard Symbols |
Xi:Irritant
|
| |
 |
