Identification |
Name: | p-Chlorofluorobenzene |
Synonyms: | 4-FLUOROCHLOROBENZENE; 4-CHLOROFLUOROBENZENE; 1,4-Fluorochlorobenzene; 1-chloro-4-fluoro-benzen; 1-Fluoro-4-chlorobenzene; P-FLUOROCHLOROBENZENE; 4-CHLOROFLUOROBENZENE 99% (GC) |
CAS: | 352-33-0 |
EINECS: | 206-521-1 |
Molecular Formula: | C6H4ClF |
Molecular Weight: | 130.55 |
InChI: | InChI=1/C6H4ClF/c7-5-1-3-6(8)4-2-5/h1-4H |
Molecular Structure: |
|
Properties |
Transport: | UN 1993 |
Density: | 1.226 |
Stability: | Stable under normal temperatures and pressures. |
Refractive index: | 1.494-1.496 |
Solubility: | Insoluble |
Appearance: | Clear colourless to light yellow liquid |
Packinggroup: | III |
Storage Temperature: | Flammables area |
Safety Data |
Hazard Symbols |
Xi:Irritant
|
|
|