| Identification | |
| Name: | Benzoic acid,4-hydroxy-, propyl ester, sodium salt (1:1) |
| Synonyms: | Benzoicacid, 4-hydroxy-, propyl ester, sodium salt (9CI);Nipasol M Sodium;Propyl 4-hydroxybenzoate sodium salt;Propyl p-hydroxybenzoate sodium salt;Propylparaben sodium;Sodium propyl 4-hydroxybenzoate;Sodium propylp-hydroxybenzoate; |
| CAS: | 35285-69-9 |
| EINECS: | 252-488-1 |
| Molecular Formula: | C10H11NaO3 |
| Molecular Weight: | 180.20048 |
| InChI: | InChI=1S/C10H12O3/c1-2-7-13-10(12)8-3-5-9(11)6-4-8/h3-6,11H,2,7H2,1H3 |
| Molecular Structure: |  |
| Properties | |
| Transport: | 25kgs |
| Melting Point: | 96-97 deg C |
| Density: | g/cm3 |
| Water Solubility: | Soluble in water |
| Solubility: | Soluble in water |
| Appearance: | White hygroscopic powder |
| Specification: |
?Sodium propylparaben , its cas register number is 35285-69-9. It also can be called Propyl p-hydroxybenzoate sodium salt ; Propylparaben sodium ; Sodium propyl p-hydroxybenzoate ; 4-Hydroxybenzoic acid propyl ester sodium salt ; and Sodium Propyl 4-hydroxybenzoate sodium salt . Sodium propylparaben (CAS NO.35285-69-9) should be?kept in a cool, well-ventilated place. Combustible materials should be stored away from extreme heat and away from strong oxidizing agents. |
| Color: | White crystals Prisms from ether |
| Safety Data | |
| Hazard Symbols | |
 |
|
