| Identification | |
| Name: | Honokiol |
| Synonyms: | [1,1'-Biphenyl]-2,4'-diol,3',5-di-2-propenyl- (9CI);3',5-Diallyl-2,4'-biphenyldiol;NSC 293100;Honokiol,(S); |
| CAS: | 35354-74-6 |
| Molecular Formula: | C18H18O2 |
| Molecular Weight: | 266.33432 |
| InChI: | InChI=1S/C18H18O2/c1-3-5-13-7-9-18(20)16(11-13)14-8-10-17(19)15(12-14)6-4-2/h3-4,7-12,19-20H,1-2,5-6H2 |
| Molecular Structure: | ![(C18H18O2) [1,1'-Biphenyl]-2,4'-diol,3',5-di-2-propenyl- (9CI);3',5-Diallyl-2,4'-biphenyldiol;NSC 293100;Honoki...](https://img.guidechem.com/casimg/35354-74-6.gif) |
| Properties | |
| Transport: | UN 3077 |
| Melting Point: | 87.50oC |
| Density: | 1.107 g/cm3 |
| Stability: | Stable at normal temperatures and pressures. |
| Refractive index: | 1.601 |
| Water Solubility: | DMSO: 36 mg/mL |
| Solubility: | DMSO: 36 mg/mL |
| Appearance: | Dark brown to white fine powder with pleasant odor, spicy and slightly bitter taste. |
| Usage: | An anxiolytic, anti-thrombotic, anti-depressant, anti-emetic, and anti-bacterial. |
| Safety Data | |
| Hazard Symbols |
Xi:Irritant
|
 |
|
