| Identification |
| Name: | L-Cysteine,S-[[(phenylmethyl)amino]thioxomethyl]- |
| Synonyms: | L-Cysteine,(phenylmethyl)carbamodithioate (ester) (9CI); Uraton |
| CAS: | 35446-36-7 |
| Molecular Formula: | C11H14 N2 O2 S2 |
| Molecular Weight: | 270.37 |
| InChI: | InChI=1/C11H14N2O2S2/c12-9(10(14)15)7-17-11(16)13-6-8-4-2-1-3-5-8/h1-5,9H,6-7,12H2,(H,13,16)(H,14,15)/t9-/m1/s1 |
| Molecular Structure: |
 |
| Properties |
| Melting Point: | 191-193 |
| Density: | 1.363 g/cm3 |
| Refractive index: | 1.665 |
| Storage Temperature: | −20°C |
| Usage: | Induction of Glutathione S-transerase (GST) activity by anticarcinogenic compounds is believed to be a major mechanism for carcinogen detoxification. This compound has shown to induce Glutathione S-transerase activity in target organs of mice with no a |
| Safety Data |
| Hazard Symbols |
Xi: Irritant
|
| |
 |
