| Identification | |
| Name: | a-D-Galactopyranoside,phenylmethyl 2-(acetylamino)-2-deoxy- |
| Synonyms: | Galactopyranoside,benzyl 2-acetamido-2-deoxy- (7CI);Galactopyranoside, benzyl2-acetamido-2-deoxy-, a-D- (8CI);Benzyl 2-acetamido-2-deoxy-a-D-galactopyranoside;Benzyl N-acetyl-a-D-galactosaminide; |
| CAS: | 3554-93-6 |
| Molecular Formula: | C15H21NO6 |
| Molecular Weight: | 311.33 |
| InChI: | InChI=1/C15H21NO6/c1-9(18)16-12-14(20)13(19)11(7-17)22-15(12)21-8-10-5-3-2-4-6-10/h2-6,11-15,17,19-20H,7-8H2,1H3,(H,16,18)/t11-,12-,13+,14-,15+/m1/s1 |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 313.6°C |
| Boiling Point: | 594.9°Cat760mmHg |
| Density: | 1.34g/cm3 |
| Refractive index: | 1.59 |
| Flash Point: | 313.6°C |
| Storage Temperature: | −20°C |
| Usage: | A substrate for N-acetyl-?-D-glucosaminyltransferase. Also an inhibitor of 1-?-3-galctotransferase. Blocks the apical biosynthetic pathway in polarized HT-29 cells. |
| Safety Data | |
| Hazard Symbols |
Xi: Irritant
|
 |
|
