| Identification | |
| Name: | Benzene,1,2,3,4,5-pentabromo-6-(2-propen-1-yloxy)- |
| Synonyms: | Benzene,pentabromo(2-propenyloxy)- (9CI); Ether, allyl pentabromophenyl (7CI,8CI);(Allyloxy)pentabromobenzene; Allyl pentabromophenyl ether; Flammex 5AE;Pentabromophenol allyl ether; Pentabromophenyl allyl ether |
| CAS: | 3555-11-1 |
| EINECS: | 222-610-8 |
| Molecular Formula: | C9H5 Br5 O |
| Molecular Weight: | 528.69 |
| InChI: | InChI=1/C9H5Br5O/c1-2-3-15-9-7(13)5(11)4(10)6(12)8(9)14/h2H,1,3H2 |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 173.9°C |
| Boiling Point: | 420.4°Cat760mmHg |
| Density: | 2.376g/cm3 |
| Refractive index: | 1.642 |
| Specification: |
Pentabromo(2-propenyloxy)benzene , its cas register number is 3555-11-1. It also can be called Allyl pentabromophenyl ether ; 1-Pentabromophenoxy-2-propene ; and Benzene, 1,2,3,4,5-pentabromo-6-(2-propen-1-yloxy)- . |
| Report: |
Reported in EPA TSCA Inventory. |
| Flash Point: | 173.9°C |
| Safety Data | |
 |
|
