| Identification |
| Name: | L-Alanine,3-amino-N-[(phenylmethoxy)carbonyl]-, methyl ester, hydrochloride (1:1) |
| Synonyms: | L-Alanine,3-amino-N-[(phenylmethoxy)carbonyl]-, methyl ester, monohydrochloride (9CI);(S)-Methyl 3-amino-2-(benzyloxycarbonylamino)propionate hydrochloride |
| CAS: | 35761-27-4 |
| Molecular Formula: | C12H16 N2 O4 . Cl H |
| Molecular Weight: | 288.73 |
| InChI: | InChI=1/C12H16N2O4/c1-17-11(15)10(7-13)14-12(16)18-8-9-5-3-2-4-6-9/h2-6,10H,7-8,13H2,1H3,(H,14,16)/t10-/m0/s1 |
| Molecular Structure: |
![(C12H16N2O4.ClH) L-Alanine,3-amino-N-[(phenylmethoxy)carbonyl]-, methyl ester, monohydrochloride (9CI);(S)-Methyl 3-a...](https://img1.guidechem.com/chem/e/dict/140/35761-27-4.jpg) |
| Properties |
| Flash Point: | 210.042°C |
| Boiling Point: | 423.692°C at 760 mmHg |
| Density: | 1.212g/cm3 |
| Refractive index: | 1.537 |
| Flash Point: | 210.042°C |
| Usage: | Important building block for the synthesis of peptides containing DAP residues, e.g. bleomycins, edeines, tuberactinomycins |
| Safety Data |
| |
 |
