| Identification | |
| Name: | 4,5-Dimethylthiazole |
| Synonyms: | FEMA No. 3274;Thiazole, 4,5-dimethyl-;4,5-Dimethyl-1,3-thiazole;4,5-Dimethyl thiazole; |
| CAS: | 3581-91-7 |
| EINECS: | 222-703-3 |
| Molecular Formula: | C5H7NS |
| Molecular Weight: | 113.18 |
| InChI: | InChI=1/C5H7NS/c1-4-5(2)7-3-6-4/h3H,1-2H3 |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN 1993 3/PG 3 |
| Melting Point: | 83-84oC |
| Density: | 1.07 |
| Stability: | Stable at room temperature in closed containers under normal storage and handling conditions. |
| Refractive index: | 1.52-1.522 |
| Solubility: | Slightly soluble |
| Appearance: | Colorless to light yellow liquid |
| Specification: |
?4,5-Dimethylthiazole (CAS NO.3581-91-7), its Synonyms are FEMA No. 3274 ; Thiazole, 4,5-dimethyl- ; 4,5-Dimethyl-1,3-thiazole . |
| Packinggroup: | III |
| Storage Temperature: | Keep away from heat, sparks, and flame. Keep away from sources of ignition. Store in a tightly closed container. Store in a cool, dry, well-ventilated area away from incompatible substances. Flammables-area. |
| Safety Data | |
| Hazard Symbols |
Xn:Harmful
|
 |
|
