| Identification |
| Name: | N-Benzyl-4-piperidone |
| Synonyms: | 4-Piperidone,1-benzyl- (6CI,7CI,8CI);1-(Phenylmethyl)-4-piperidinone;1-(Phenylmethyl)-4-piperidone;1-Benzyl-4-oxopiperidine;1-Benzyl-4-piperidinone;1-Benzyl-4-piperidone; |
| CAS: | 3612-20-2 |
| EINECS: | 222-782-4 |
| Molecular Formula: | C12H15NO |
| Molecular Weight: | 189.26 |
| InChI: | InChI=1/C12H15NO/c14-12-6-8-13(9-7-12)10-11-4-2-1-3-5-11/h1-5H,6-10H2 |
| Molecular Structure: |
 |
| Properties |
| Transport: | OTH |
| Density: | 1.069 |
| Stability: | Stable under normal temperatures and pressures. |
| Refractive index: | 1.539-1.54 |
| Appearance: | clear to yellow oilyliquid |
| Packinggroup: | II |
| HS Code: | 29333999 |
| Storage Temperature: | Keep away from heat, sparks, and flame. Keep away from sources of ignition. Store in a tightly closed container. Store in a cool, dry, well-ventilated area away from incompatible substances. |
| Safety Data |
| Hazard Symbols |
Xn:Harmful
|
| |
 |
