| Identification |
| Name: | Prosta-5,13-dien-1-oicacid, 11,15-dihydroxy-9-oxo-, (5Z,11a,13E,15S)- |
| Synonyms: | 5-Heptenoicacid, 7-[3-hydroxy-2-(3-hydroxy-1-octenyl)-5-oxocyclopentyl]- (8CI);(-)-Prostaglandin E2;(15S)-Prostaglandin E2;11,15-Dihydroxy-9-oxoprosta-5,13-dien-1-oic acid (5Z,11a,13E,15S);11a,15a-Dihydroxy-9-oxo-5-cis,13-trans-prostadienoic acid;Cervidil;Cerviprime;Dinoprostone;Enzaprost E;Minprositin E2;NSC 196514;PGE2;Primiprost;Prostaglandin E2;Prostenon;Prostenone;Prostin (prostaglandin);U 12062;Vivelle-Dot;l-Prostaglandin E2; |
| CAS: | 363-24-6 |
| EINECS: | 206-656-6 |
| Molecular Formula: | C20H32O5 |
| Molecular Weight: | 352.46508 |
| InChI: | InChI=1S/C20H32O5/c1-2-3-6-9-15(21)12-13-17-16(18(22)14-19(17)23)10-7-4-5-8-11-20(24)25/h4,7,12-13,15-17,19,21,23H,2-3,5-6,8-11,14H2,1H3,(H,24,25)/b7-4-,13-12+/t15-,16+,17+,19+/m0/s1 |
| Molecular Structure: |
![(C20H32O5) 5-Heptenoicacid, 7-[3-hydroxy-2-(3-hydroxy-1-octenyl)-5-oxocyclopentyl]- (8CI);(-)-Prostaglandin E2;...](https://img1.guidechem.com/chem/e/dict/179/363-24-6.jpg) |
| Properties |
| Melting Point: | 66-68 ºC |
| Flash Point: | 288.5°C |
| Boiling Point: | 530.1°Cat760mmHg |
| Density: | 1.148g/cm3 |
| Stability: | Stable under normal temperatures and pressures. Light sensitive. |
| Alpha: | -85.5 º (C=1, C2H5OH) |
| Water Solubility: | insoluble |
| Solubility: | insoluble |
| Appearance: | White crystals. |
| Biological Activity: | Endogenous prostaglandin and primary product of arachidonic acid/cyclooxygenase pathway. Binds with high affinity to EP 1 , EP 2 , EP 3 and EP 4 receptors (K d values range between ~ 1-10 nM). Influences a wide range of processes including inflammation, smooth muscle relaxation, fertility and gastric mucosal integrity. Regulates vertebrate hematopoietic stem cell (HSC) homeostasis. |
| Flash Point: | 288.5°C |
| Storage Temperature: | −20°C |
| Usage: | The most common and most biologically potent of mammalian prostaglandins |
| Safety Data |
| Hazard Symbols |
T: Toxic
|
| |
 |
