| Identification | |
| Name: | 2,5-Dibromoaniline |
| Synonyms: | 2,5-Dibromobenzenamine |
| CAS: | 3638-73-1 |
| EINECS: | 222-865-5 |
| Molecular Formula: | C6H5Br2N |
| Molecular Weight: | 250.92 |
| InChI: | InChI=1/C6H5Br2N/c7-4-1-2-5(8)6(9)3-4/h1-3H,9H2 |
| Molecular Structure: |  |
| Properties | |
| Transport: | 50kgs |
| Boiling Point: | 281.4 ºC at 760 mmHg |
| Density: | 2.022 g/cm3 |
| Stability: | Stable at room temperature in closed containers under normal storage and handling conditions. |
| Refractive index: | 1.661 |
| Appearance: | grey solid |
| Specification: |
Storage of 2,5-Dibromoaniline (CAS NO.3638-73-1): Store away from oxidizing agents. Do not store together with acids. Keep container tightly sealed. Store in cool, dry conditions in well sealed containers. Store under lock and key and with access restricted to technical experts or their assistants only. |
| Packinggroup: | III |
| Storage Temperature: | Store in a tightly closed container. Store in a cool, dry, well-ventilated area away from incompatible substances. |
| Safety Data | |
| Hazard Symbols |
Xn:Harmful
|
 |
|
