| Identification | |
| Name: | 3-Azetidinecarboxylicacid |
| Synonyms: | 3-Carboxyazetidine; |
| CAS: | 36476-78-5 |
| Molecular Formula: | C4H7NO2 |
| Molecular Weight: | 101.10388 |
| InChI: | InChI=1S/C4H7NO2/c6-4(7)3-1-5-2-3/h3,5H,1-2H2,(H,6,7) |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 100.1 oC |
| Boiling Point: | 242 oC at 760 mmHg |
| Density: | 1.275 g/cm3 |
| Refractive index: | 1.499 |
| Appearance: | light yellow powder |
| Specification: |
??3-Azetidinecarboxylic acid , its cas register number is 36476-78-5. It also can be called?3-Carboxyazetidine ; 5-22-01-00023 (Beilstein Handbook Reference) ; Azetidine-3-carboxylic acid ; CHA-811 ; Caswell No. 063C ; EPA Pesticide Chemical Code 128830 .?3-Azetidinecarboxylic acid (CAS NO.36476-78-5) is a?light yellow powder. |
| Flash Point: | 100.1 oC |
| Usage: | A useful intermediate in the synthesis of polypeptides. |
| Safety Data | |
 |
|
