| Identification | |
| Name: | Pentachlorophenyl propyl ether |
| Synonyms: | Pentachlorophenyl propyl ether;CP 293;Benzene, pentachloropropoxy-;1,2,3,4,5-pentachloro-6-propoxybenzene;36518-74-8;AC1L4QBM;AC1Q3LEH;KST-1B4096;KST-1B4097;AR-1B5072;AR-1B5073;LS-30933 |
| CAS: | 36518-74-8 |
| Molecular Formula: | C9H7Cl5O |
| Molecular Weight: | 308.4163 |
| InChI: | InChI=1/C9H7Cl5O/c1-2-3-15-9-7(13)5(11)4(10)6(12)8(9)14/h2-3H2,1H3 |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 129.7°C |
| Boiling Point: | 349.5°C at 760 mmHg |
| Density: | 1.495g/cm3 |
| Refractive index: | 1.559 |
| Specification: |
Pentachlorophenyl propyl ether , its cas register number is 36518-74-8. It also can be called Benzene, pentachloropropoxy- ; and CP 293 . |
| Flash Point: | 129.7°C |
| Safety Data | |
 |
|
