| Identification |
| Name: | Benzene,1-chloro-2,3,4-trifluoro- |
| Synonyms: | 1-Chloro-2,3,4-trifluorobenzene;4-Chloro-1,2,3-trifluorobenzene; |
| CAS: | 36556-42-0 |
| Molecular Formula: | C6H2ClF3 |
| Molecular Weight: | 166.53 |
| InChI: | InChI=1/C6H2ClF3/c7-3-1-2-4(8)6(10)5(3)9/h1-2H |
| Molecular Structure: |
 |
| Properties |
| Density: | 1.46 g/cm3 |
| Refractive index: | 1.458 |
| Safety Data |
| Hazard Symbols |
Xi: Irritant
|
| |
 |