| Identification | |
| Name: | 2,2'-Dipyridyl |
| Synonyms: | 2,2-Dipyridyl (2,2-bipyridine); BipyridineBIPYwhiteoffwhitextl; 2,2-Dipyridyl 99.5+ % for analysis; 2,2-Bipyridyl; 2,2-Bipyridine; 2,2-Dipyridine |
| CAS: | 366-18-7 |
| EINECS: | 206-674-4 |
| Molecular Formula: | C10H8N2 |
| Molecular Weight: | 156.19 |
| InChI: | InChI=1/C10H8N2/c1-3-7-11-9(5-1)10-6-2-4-8-12-10/h1-8H |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN 1663/2811 |
| Density: | 272 |
| Stability: | Stable. Incompatible with strong oxidizing agents, most common metals. May be light sensitive. |
| Refractive index: | 1.58 |
| Solubility: | Slightly soluble (soluble in alcohol , ether, benzene, chloroform) AUTOIGNITIO |
| Appearance: | white to off-white powder |
| Specification: |
2,2'-Bipyridine (CAS NO.366-18-7) is a white crystalline powder.?Product Categories about it are?Pyridine ; Pyridines derivates ; Analytical Chemistry ; Bipyridyls, etc. (Chelating Reagents) ; Chelating Reagents ; Aromatics ; Metalloprotease inhibitorProtease Inhibitors ; Metalloproteinase InhibitorsEnzyme Inhibitors ; Broad Spectrum Inhibitors of Proteolytic Enzyme Classes ; Enzyme Inhibitors by Enzyme ; L to ; Protease Inhibitors ; C9 to C46Derivatization Reagents TLC ; TLC Reagents, D-FDerivatization Reagents TLC ; Heterocyclic Building Blocks ; Pyridines ; Vitamins ; Metal IonsTitration ; TLC Reagents, A-CSpectroscopy ; Derivatization Reagents TLC ; Indicators ; Redox IndicatorsDerivatization Reagents TLC ; TLC Visualization Reagents (alphabetic sort) ; TLC Visualization Reagents (by application) ; UV/Vis Reagents ; UV/Visible (UV/VIS) Spectroscopy ; A-BAlphabetic ; Alpha sort ; B ; BI - BZ ; Pesticides&Metabolites. |
| Packinggroup: | III |
| HS Code: | 29333999 |
| Storage Temperature: | Store at RT. |
| Color: | White crystals Crystals from dilute alcohol PRISMS FROM PETROLEUM ETHER |
| Usage: | As a reagent for the determination of iron. |
| Safety Data | |
| Hazard Symbols |
T:Toxic
|
 |
|
