| Identification |
| Name: | 2-Fluorophenol |
| Synonyms: | Fluorophenolmincolorlessliq |
| CAS: | 367-12-4 |
| EINECS: | 206-681-2 |
| Molecular Formula: | C6H5FO |
| Molecular Weight: | 112.1 |
| InChI: | InChI=1/C6H5FO/c7-5-3-1-2-4-6(5)8/h1-4,8H |
| Molecular Structure: |
 |
| Properties |
| Transport: | 200kgs |
| Density: | 1.256 |
| Stability: | Stable. Flammable. Incompatible with strong oxidizing agents. |
| Refractive index: | 1.5134-1.5154 |
| Water Solubility: | moderately soluble |
| Solubility: | moderately soluble |
| Appearance: | Clear to oragne liquid or solid |
| Packinggroup: | III |
| HS Code: | 29081000 |
| Storage Temperature: | Flammables area |
| Safety Data |
| Hazard Symbols |
Xn:Harmful
|
| |
 |
