| Identification | |
| Name: | b-D-Galactopyranoside, 1-methylethyl 1-thio- |
| Synonyms: | Galactopyranoside,isopropyl 1-thio- (7CI);Galactopyranoside, isopropyl 1-thio-, b-D- (8CI);IPTG;Isopropyl 1-thio-b-D-galactopyranoside;Isopropyl thio-b-D-galactopyranoside;Isopropyl thio-b-D-galactoside;Isopropyl b-thiogalactopyranoside;Isopropyl b-thiogalactoside; |
| CAS: | 367-93-1 |
| EINECS: | 206-703-0 |
| Molecular Formula: | C9H18O5S |
| Molecular Weight: | 238.3 |
| InChI: | InChI=1/C9H18O5S/c1-4(2)15-9-8(13)7(12)6(11)5(3-10)14-9/h4-13H,3H2,1-2H3/t5-,6+,7+,8-,9+/m1/s1 |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 219 oC |
| Boiling Point: | 438.4 oC at 760 mmHg |
| Density: | 1.37 g/cm3 |
| Stability: | Stable. Incompatible with strong oxidizing agents. |
| Refractive index: | 1.577 |
| Alpha: | -31 o (C=1, WATER) |
| Water Solubility: | soluble |
| Solubility: | soluble |
| Appearance: | white crystals |
| Flash Point: | 219 oC |
| Usage: | A ?Galactosidase inducer used also as an inducer for the activity of E. Coli lac operon |
| Safety Data | |
| Hazard Symbols |
Xn:Harmful
|
 |
|
