| Identification |
| Name: | Pentanoic acid,2-furanylmethyl ester |
| Synonyms: | Furfurylpentanoate; Furfuryl valerate; Oxaromate 884 |
| CAS: | 36701-01-6 |
| EINECS: | 253-160-0 |
| Molecular Formula: | C10H14 O3 |
| Molecular Weight: | 182.22 |
| InChI: | InChI=1/C10H14O3/c1-2-3-6-10(11)13-8-9-5-4-7-12-9/h4-5,7H,2-3,6,8H2,1H3 |
| Molecular Structure: |
 |
| Properties |
| Flash Point: | 98.3°C |
| Boiling Point: | 230.2°Cat760mmHg |
| Density: | 1.043g/cm3 |
| Stability: | Stable at normal temperatures and pressures. |
| Refractive index: | n20/D 1.46(lit.) |
| Solubility: | Insoluble |
| Appearance: | Liquid. |
| Flash Point: | 98.3°C |
| Storage Temperature: | Can discolor during storage. Protect from light, including direct sun rays. Keep away from heat, sparks and open flame. Keep containers tightly closed. Keep in original container. |
| Safety Data |
| |
 |
