| Identification | |
| Name: | Arsine, difluorophenyl- |
| Synonyms: | Difluorophenylarsenic;Difluorophenylarsine;Phenyldifluoroarsine |
| CAS: | 368-97-8 |
| Molecular Formula: | C6H5AsF2 |
| Molecular Weight: | 0 |
| InChI: | InChI=1/C6H5AsF2/c8-7(9)6-4-2-1-3-5-6/h1-5H |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 64.3°C |
| Boiling Point: | 206.6°C at 760 mmHg |
| Density: | g/cm3 |
| Specification: |
Arsine, difluorophenyl- (CAS NO.368-97-8) is also named as 3-16-00-00958 (Beilstein Handbook Reference) ; BRN 3235616 . |
| Report: |
Arsenic and its compounds are on the Community Right-To-Know List. |
| Flash Point: | 64.3°C |
| Safety Data | |
 |
|
