| Identification |
| Name: | Rhodamine B isothiocyanate |
| Synonyms: | 9-[2-Carboxy-5-isothiocyanatophenyl]-3,6-bis(diethylamino)xanthylium chloride |
| CAS: | 36877-69-7 |
| EINECS: | 253-248-9 |
| Molecular Formula: | C29H30ClN3O3S |
| Molecular Weight: | 536.08 |
| InChI: | InChI=1/C29H29N3O3S/c1-5-31(6-2)20-10-13-23-26(16-20)34-27-17-21(32(7-3)8-4)11-14-24(27)29(23)25-15-19(30-18-36)9-12-22(25)28(33)35-29/h9-17H,5-8H2,1-4H3 |
| Molecular Structure: |
![(C29H30ClN3O3S) 9-[2-Carboxy-5-isothiocyanatophenyl]-3,6-bis(diethylamino)xanthylium chloride](https://img.guidechem.com/structureimg/36877-69-7.gif) |
| Properties |
| Transport: | UN 3335 |
| Flash Point: | 387.6°C |
| Boiling Point: | 717.2°C at 760 mmHg |
| Density: | 1.23g/cm3 |
| Stability: | Stable, but may be sensitive to light or moisture. Store dark and dry. Incompatible with strong oxidizing agents. |
| Refractive index: | 1.639 |
| Flash Point: | 387.6°C |
| Storage Temperature: | 2-8°C |
| Safety Data |
| |
 |