| Identification | |
| Name: | 3,4-Difluoroacetophenone |
| Synonyms: | Acetophenone,3',4'-difluoro- (8CI);1-(3,4-Difluorophenyl)ethan-1-one;1-(3,4-Difluorophenyl)ethanone;Ethanone,1-(3,4-difluorophenyl)-; |
| CAS: | 369-33-5 |
| EINECS: | 206-717-7 |
| Molecular Formula: | C8H6F2O |
| Molecular Weight: | 156.13 |
| InChI: | InChI=1/C8H6F2O/c1-5(11)6-2-3-7(9)8(10)4-6/h2-4H,1H3 |
| Molecular Structure: |  |
| Properties | |
| Density: | 1.246 |
| Stability: | Stable under normal temperatures and pressures. |
| Refractive index: | 1.4906-1.4926 |
| Water Solubility: | INSOLUBLE |
| Solubility: | INSOLUBLE |
| Appearance: | clear yellowish liquid after melting |
| Specification: |
3,4-Difluoroacetophenone (CAS NO.369-33-5), its Synonyms are 1-(3,4-Difluorophenyl)ethan-1-one ; Ethanone, 1-(3,4-difluorophenyl)- ; 3',4'-Difluoroacetophenone ; 1-(3,4-Difluorophenyl)ethanone . |
| Storage Temperature: | Keep away from sources of ignition. Store in a cool, dry place. Store in a tightly closed container. |
| Safety Data | |
| Hazard Symbols |
Xi:Irritant
|
 |
|
