| Identification |
| Name: | 1-PHENYL-3-PYRIDIN-4-YL-1H-PYRAZOLE-4-CARBALDEHYDE |
| Synonyms: | 1-PHENYL-3-PYRIDIN-4-YL-1H-PYRAZOLE-4-CARBALDEHYDE;CHEMBRDG-BB 5920292 |
| CAS: | 371917-81-6 |
| Molecular Formula: | C15H11N3O |
| Molecular Weight: | 249.27 |
| InChI: | InChI=1/C15H11N3O/c19-11-13-10-18(14-4-2-1-3-5-14)17-15(13)12-6-8-16-9-7-12/h1-11H |
| Molecular Structure: |
 |
| Properties |
| Flash Point: | 227.5°C |
| Boiling Point: | 452.5°C at 760 mmHg |
| Density: | 1.2g/cm3 |
| Refractive index: | 1.647 |
| Flash Point: | 227.5°C |
| Safety Data |
| |
 |