| Identification | |
| Name: | 3-methyl-5-propylcyclohex-2-enone |
| Synonyms: | 3-Methyl-5-propyl-2-cyclohexen-1-one |
| CAS: | 3720-16-9 |
| EINECS: | 223-069-0 |
| Molecular Formula: | C10H16O |
| Molecular Weight: | 152.23344 |
| InChI: | InChI=1S/C10H16O/c1-3-4-9-5-8(2)6-10(11)7-9/h6,9H,3-5,7H2,1-2H3 |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 94.6 ºC |
| Boiling Point: | 231.3 ºC at 760 mmHg |
| Density: | 0.904 g/cm3 |
| Refractive index: | 1.459 |
| Water Solubility: | insoluble in water; soluble in ether and oils |
| Solubility: | insoluble in water; soluble in ether and oils |
| Appearance: | Pale yellow to colourless liquid; warm spicy woody odour, similar flavor at low levels |
| Specification: |
2-Cyclohexen-1-one,3-methyl-5-propyl- (CAS NO.3720-16-9), its Synonyms are 3-Methyl-5-propyl-2-cyclohexen-1-one ; Celery ketone ; 3-Methyl-5-propylcyclohex-2-enone . |
| Flash Point: | 94.6 ºC |
| Safety Data | |
 |
|
