Identification |
Name: | (Chloromethylene)-dimethylammonium chloride |
Synonyms: | (Chloromethylene)dimethyliminium chloride |
CAS: | 3724-43-4 |
EINECS: | 425-970-6 |
Molecular Formula: | C3H7Cl2N |
Molecular Weight: | 128 |
InChI: | InChI=1/C3H7ClN.ClH/c1-5(2)3-4;/h3H,1-2H3;1H/q+1;/p-1 |
Molecular Structure: |
|
Properties |
Transport: | UN 3261 |
Flash Point: | °C |
Boiling Point: | °Cat760mmHg |
Density: | g/cm3 |
Stability: | Stable under normal temperatures and pressures. Combines vigorously with water with the evolution of heat. |
Water Solubility: | reacts |
Solubility: | REACTS with water |
Appearance: | White to off-white powder |
Packinggroup: | II |
HS Code: | 29252000 |
Flash Point: | °C |
Storage Temperature: | 2-8°C |
Sensitive: | Moisture Sensitive |
Safety Data |
Hazard Symbols |
T:Toxic
|
|
|