| Identification | |
| Name: | Benzenamine,N,N-dimethyl-4-[2-(2-methylphenyl)diazenyl]- |
| Synonyms: | Aniline,N,N-dimethyl-p-(o-tolylazo)- (7CI,8CI); Benzenamine,N,N-dimethyl-4-[(2-methylphenyl)azo]- (9CI);2-Methyl-4'-(dimethylamino)azobenzene; 2'-Methyl-4-(dimethylamino)azobenzene;2'-Methyl-p-(dimethylamino)azobenzene; 4-(Dimethylamino)-2'-methylazobenzene;N,N-Dimethyl-p-(o-tolylazo)aniline; NSC 102373 |
| CAS: | 3731-39-3 |
| EINECS: | 223-088-4 |
| Molecular Formula: | C15H17 N3 |
| Molecular Weight: | 239.35 |
| InChI: | InChI=1/C15H17N3/c1-12-6-4-5-7-15(12)17-16-13-8-10-14(11-9-13)18(2)3/h4-11H,1-3H3/b17-16+ |
| Molecular Structure: | ![(C15H17N3) Aniline,N,N-dimethyl-p-(o-tolylazo)- (7CI,8CI); Benzenamine,N,N-dimethyl-4-[(2-methylphenyl)azo]- (9...](https://img1.guidechem.com/chem/e/dict/34/3731-39-3.jpg) |
| Properties | |
| Melting Point: | 74 °C |
| Flash Point: | 190.2°C |
| Boiling Point: | 390.9°Cat760mmHg |
| Density: | 1.01g/cm3 |
| Refractive index: | 1.561 |
| Specification: |
N,N-Dimethyl-p-((o-tolyl)azo)aniline (CAS NO.3731-39-3) can be explosive when suspended in air at specific concentrations. It is an azo compound. Azo, diazo, azido compounds can detonate. This applies in particular to organic azides that have been sensitized by the addition of metal salts or strong acids. Toxic gases are formed by mixing materials of this class with acids, aldehydes, amides, carbamates, cyanides, inorganic fluorides, halogenated organics, isocyanates, ketones, metals, nitrides, peroxides, phenols, epoxides, acyl halides, and strong oxidizing or reducing agents. Flammable gases are formed by mixing materials in this group with alkali metals. Explosive combination can occur with strong oxidizing agents, metal salts, peroxides, and sulfides. |
| Flash Point: | 190.2°C |
| Safety Data | |
 |
|
