| Identification | |
| Name: | Ryoto Sugar Ester S 1570 |
| CAS: | 37318-31-3 |
| EINECS: | 253-459-6 |
| Molecular Formula: | C30H58O13 |
| Molecular Weight: | 626.7737 |
| InChI: | InChI=1/C18H36O2.C12H22O11/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18(19)20;13-1-4-6(16)8(18)10(20)12(21,23-4)11(3-15)9(19)7(17)5(2-14)22-11/h2-17H2,1H3,(H,19,20);4-10,13-21H,1-3H2/t;4-,5-,6-,7-,8+,9+,10-,11+,12-/m.1/s1 |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 388.2 °C |
| Boiling Point: | 718.3 °C at 760mmHg |
| Appearance: | white to pale yellow powder or wax, or lumps, or colorless to slightly yellow viscous liquid |
| Specification: |
Ryoto Sugar Ester S 1570 (CAS NO.37318-31-3) is also named as alpha-D-Glucopyranoside, beta-D-fructofuranosyl, octadecanoate ; Ryoto Sugar Ester S 270 ; See R-D-Glucopyranoside,â-D-fructofuranosyl,esters,octadecanoate ; Sucroester WE 11 ; α-d-Glucopyranoside, β-d-fructofuranosyl, octadecanoate ; Sucrose fatty acid esters . Ryoto Sugar Ester S 1570 (CAS NO.37318-31-3) is white to pale yellow powder or wax, or lumps, or colorless to slightly yellow viscous liquid. |
| Flash Point: | 388.2 °C |
| Safety Data | |
 |
|
