| Identification | |
| Name: | Pyridine,2-bromo-3-fluoro-6-methyl- |
| Synonyms: | 2-Bromo-3-fluoro-6-methylpyridine |
| CAS: | 374633-36-0 |
| Molecular Formula: | C6H5BrFN |
| Molecular Weight: | 190.014803 |
| InChI: | InChI=1/C6H5BrFN/c1-4-2-3-5(8)6(7)9-4/h2-3H,1H3 |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 66°C |
| Boiling Point: | 185.6°C at 760 mmHg |
| Density: | 1.592g/cm3 |
| Refractive index: | 1.529 |
| Specification: |
2-Bromo-3-fluoro-6-methylpyridine with cas registry number of 374633-36-0 is also known as 2-Brom-3-fluor-6-methylpyridin ; 2-Bromo-3-fluoro-6-methylpyridine ; Pyridine, 2-bromo-3-fluoro-6-methyl- ; 2-Bromo-3-fluoro-6-methyl-pyridine ; 2-Bromo-3-fluoro-6-picoline . It would emit acrid smoke and irritating fumes when heated to decomposition . It should be stored in a cool, dry place and kept container closed when not in use. |
| Flash Point: | 66°C |
| Safety Data | |
 |
|
