| Identification |
| Name: | Ethanone,1-(4-hexylphenyl)- |
| Synonyms: | 4-(1-Hexyl)acetophenone;4-Hexylacetophenone;4-n-Hexylacetophenone;4'-Hexylacetophenone;p-Hexylacetophenone;p-n-Hexylacetophenone;p-Hexylacetophenone; |
| CAS: | 37592-72-6 |
| Molecular Formula: | C14H20O |
| Molecular Weight: | 204.31 |
| InChI: | InChI=1/C14H20O/c1-3-4-5-6-7-13-8-10-14(11-9-13)12(2)15/h8-11H,3-7H2,1-2H3 |
| Molecular Structure: |
 |
| Properties |
| Flash Point: | 132-135ºC/2mm |
| Boiling Point: | 132-135ºC/2mm |
| Density: | 0.94 |
| Refractive index: | 1.5140 |
| Water Solubility: | Nonsoluble in water. Soluble in hexane, ethanol and 2-propanol, highly soluble in acetone, toluene, dichloromethane in water |
| Solubility: | Nonsoluble in water. Soluble in hexane, ethanol and 2-propanol, highly soluble in acetone, toluene, dichloromethane in water |
| Appearance: | Clear colorless to light yellow liquid, aromatic odor |
| Flash Point: | 132-135ºC/2mm |
| Safety Data |
| |
 |
