| Identification | |
| Name: | Pyridine,5-bromo-2-iodo-3-methyl- |
| Synonyms: | 5-Bromo-2-iodo-3-methylpyridine;5-Bromo-2-iodo-?-picoline;pyridine, 5-bromo-2-iodo-3-methyl-; |
| CAS: | 376587-52-9 |
| Molecular Formula: | C6H5BrIN |
| Molecular Weight: | 297.92 |
| InChI: | InChI=1/C6H5BrIN/c1-4-2-5(7)3-9-6(4)8/h2-3H,1H3 |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 123.1°C |
| Boiling Point: | 279.9°Cat760mmHg |
| Density: | 2.171g/cm3 |
| Refractive index: | 1.646 |
| Specification: |
The 5-Bromo-2-iodo-3-methylpyridine, with the CAS registry number 376587-52-9, is also called 5-Bromo-2-iodo-ß-picoline. It belongs to the product category of Phamacitical. And the molecular formula of the chemical is C6H5BrIN. The characteristics of 5-Bromo-2-iodo-3-methylpyridine are as followings: (1)ACD/LogP: 3.31; (2)# of Rule of 5 Violations: 0 ; (3)#H bond acceptors: 1; (4)#H bond donors: 0; (5)#Freely Rotating Bonds: 0; (6)Polar Surface Area: 12.89 Å2; (7)Index of Refraction: 1.646; (8)Molar Refractivity: 49.766 cm3; (9)Molar Volume: 137.19 cm3; (10)Polarizability: 19.729×10-24cm3; (11)Surface Tension: 50.199 dyne/cm; (12)Density: 2.172 g/cm3; (13)Flash Point: 123.054 °C; (14)Enthalpy of Vaporization: 49.773 kJ/mol; (15)Boiling Point: 279.859 °C at 760 mmHg; (16)Vapour Pressure: 0.007 mmHg at 25°C. Addtionally, the following datas could be converted into the molecular structure: |
| Flash Point: | 123.1°C |
| Safety Data | |
 |
|
