| Identification | |
| Name: | 1H-Indole-2-carboxylicacid, ethyl ester |
| Synonyms: | Indole-2-carboxylicacid, ethyl ester (6CI,7CI,8CI);2-Carbethoxyindole;2-Ethoxycarbonylindole;Ethyl 1H-indole-2-carboxylate;NSC 10076; |
| CAS: | 3770-50-1 |
| EINECS: | 223-206-4 |
| Molecular Formula: | C11H11NO2 |
| Molecular Weight: | 189.21 |
| InChI: | InChI=1/C11H11NO2/c1-2-14-11(13)10-7-8-5-3-4-6-9(8)12-10/h3-7,12H,2H2,1H3 |
| Molecular Structure: |  |
| Properties | |
| Density: | 1.21 g/cm3 |
| Stability: | Stable under normal temperatures and pressures. |
| Refractive index: | 1.62 |
| Solubility: | Insoluble |
| Appearance: | slightly off-white to off-white crystalline powder |
| HS Code: | 29339990 |
| Usage: | Synthetic intermediate. |
| Safety Data | |
 |
|
