Identification |
Name: | 1H-Indole-2-carboxylicacid, ethyl ester |
Synonyms: | Indole-2-carboxylicacid, ethyl ester (6CI,7CI,8CI);2-Carbethoxyindole;2-Ethoxycarbonylindole;Ethyl 1H-indole-2-carboxylate;NSC 10076; |
CAS: | 3770-50-1 |
EINECS: | 223-206-4 |
Molecular Formula: | C11H11NO2 |
Molecular Weight: | 189.21 |
InChI: | InChI=1/C11H11NO2/c1-2-14-11(13)10-7-8-5-3-4-6-9(8)12-10/h3-7,12H,2H2,1H3 |
Molecular Structure: |
|
Properties |
Density: | 1.21 g/cm3 |
Stability: | Stable under normal temperatures and pressures. |
Refractive index: | 1.62 |
Solubility: | Insoluble |
Appearance: | slightly off-white to off-white crystalline powder |
HS Code: | 29339990 |
Usage: | Synthetic intermediate. |
Safety Data |
|
|