| Identification |
| Name: | Butanoic acid,2-[[2-[3-(acetylamino)-2,4,6-triiodophenoxy]ethoxy]methyl]- |
| Synonyms: | Bilimiro;Iopronic acid; Oravue |
| CAS: | 37723-78-7 |
| EINECS: | 253-643-6 |
| Molecular Formula: | C15H18 I3 N O5 |
| Molecular Weight: | 673.04 |
| InChI: | InChI=1/C15H18I3NO5/c1-3-9(15(21)22)7-23-4-5-24-14-11(17)6-10(16)13(12(14)18)19-8(2)20/h6,9H,3-5,7H2,1-2H3,(H,19,20)(H,21,22) |
| Molecular Structure: |
 |
| Properties |
| Flash Point: | 361.5°C |
| Boiling Point: | 674.2°Cat760mmHg |
| Density: | 2.149g/cm3 |
| Refractive index: | 1.67 |
| Specification: |
Iopronic acid , its cas register number is 37723-78-7. It also can be called Bilimiro ; (+-)-2-((2-(3-Acetamido-2,4,6-
triiodophenoxy)ethoxy)methyl)butyric acid ; and 2((3-Acetamino-2,4,6-triiodophenoxy)-2-ethoxy)methylbutyric acid .
|
| Flash Point: | 361.5°C |
| Safety Data |
| |
 |