| Identification | |
| Name: | 2-Butanol, 3-mercapto-,(2R,3S)-rel- (9CI) |
| Synonyms: | 2-Butanol,3-mercapto-, (R*,S*)-;3-Mercapto-2-butanol; |
| CAS: | 37887-04-0 |
| EINECS: | 253-701-0 |
| Molecular Formula: | C4H10OS |
| Molecular Weight: | 106.18 |
| InChI: | InChI=1/C4H10OS/c1-3(5)4(2)6/h3-6H,1-2H3 |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN 3336 |
| Flash Point: | 162.3 ºC at 760 mmHg |
| Boiling Point: | 162.3 ºC at 760 mmHg |
| Density: | 0.993 g/cm3 |
| Refractive index: | n20/D 1.48(lit.) |
| Appearance: | Colorless transparent liquid |
| Specification: |
The chemical synonyms of (R*,S*)-3-mercaptobutan-2-ol (CAS NO.37887-04-0) are FEMA 3502 ; 2-Mercapto-3-butanol;3-Mercaptobutan-2-ol ; (R*,S*)-3-mercaptobutan-2-ol ; 2-Mercapto-3-butanol 97+% ; 2-Mercapto-3-butanol fema NO.3502 ; 2-Butanol, 3-mercapto-, (2R,3S)-rel- ; 3-Thio-2-butanol . |
| Flash Point: | 162.3 ºC at 760 mmHg |
| Safety Data | |
 |
|
