| Identification | |
| Name: | 5,9-Undecadien-2-one,6,10-dimethyl-, (5E)- |
| Synonyms: | 5,9-Undecadien-2-one,6,10-dimethyl-, (E)- (8CI); (E)-6,10-Dimethyl-5,9-undecadien-2-one;(E)-Geranylacetone; 6,10-Dimethyl-(E)-5,9-undecadien-2-one;6,10-Dimethyl-(E)-5,9-undecadien-2-one; Geranylacetone;trans-6,10-Dimethyl-5,9-undecadien-2-one; trans-Geranylacetone |
| CAS: | 3796-70-1 |
| EINECS: | 223-269-8 |
| Molecular Formula: | C13H22 O |
| Molecular Weight: | 194.31 |
| InChI: | InChI=1/C13H22O/c1-11(2)7-5-8-12(3)9-6-10-13(4)14/h7,9H,5-6,8,10H2,1-4H3/b12-9+ |
| Molecular Structure: |  |
| Properties | |
| Density: | 0.873 |
| Refractive index: | 1.467 |
| Water Solubility: | slightly soluble in water; soluble in oil |
| Solubility: | slightly soluble in water; soluble in oil |
| Appearance: | Colourless slightly yellow liquid; fresh floral but penetrating sweet-rosey aroma |
| Specification: |
? 5,9-Undecadien-2-one,6,10-dimethyl-, (5E)- , with CAS number of 3796-70-1, can be called (5E)-6,10-Dimethyl-5,9-undecadien-2-one ; (E)-6,10-dimethyl-5,9- undecadien-2-one;(E)-geranylacetone ; 10-dimethyl-9-undecadien-2-on(e)-6 ; 2,6-Dimethyl-2,6-undecadien-10-one ; 6,10-dimethyl-(E)-5,9-undecadien-2-one ; 6,10-dimethyl-5,9-undecadien-2-one, (E);9-Undecadien-2-one,6,10-dimethyl-,(E)-5 . |
| Safety Data | |
| Hazard Symbols |
Xi:Irritant
|
 |
|
