| Identification |
| Name: | Ethanone,1-(2,4-dimethyl-5-thiazolyl)- |
| Synonyms: | Ketone,2,4-dimethyl-5-thiazolyl methyl (7CI);1-(2,4-Dimethylthiazol-5-yl)ethanone;2,4-Dimethyl-5-acetylthiazole; |
| CAS: | 38205-60-6 |
| EINECS: | 253-826-0 |
| Molecular Formula: | C7H9NOS |
| Molecular Weight: | 155.21 |
| InChI: | InChI=1/C7H9NOS/c1-4-7(5(2)9)10-6(3)8-4/h1-3H3 |
| Molecular Structure: |
 |
| Properties |
| Density: | 1.15 |
| Stability: | Stable at room temperature in closed containers under normal storage and handling conditions. |
| Refractive index: | 1.535-1.545 |
| Appearance: | Colorless to yellow liquid. |
| Storage Temperature: | Store in a cool place in the original container and protect from sunlight. Store in a tightly closed container. |
| Safety Data |
| Hazard Symbols |
Xi:Irritant
|
| |
 |
