| Identification |
| Name: | 1-(4-Methoxyphenyl)piperazine |
| Synonyms: | 1-(4'-Methoxyphenyl)piperazine;1-(p-Anisyl)piperazine;1-(p-Methoxyphenyl)piperazine;4-(4-Methoxyphenyl)piperazine;N-(4-Methoxyphenyl)piperazine;N-(p-Methoxyphenyl)piperazine; |
| CAS: | 38212-30-5 |
| EINECS: | 253-829-7 |
| Molecular Formula: | C11H16N2O |
| Molecular Weight: | 192.25754 |
| InChI: | InChI=1S/C11H16N2O/c1-14-11-4-2-10(3-5-11)13-8-6-12-7-9-13/h2-5,12H,6-9H2,1H3 |
| Molecular Structure: |
 |
| Properties |
| Density: | 1.057 g/cm3 |
| Stability: | Stable under normal temperatures and pressures. |
| Refractive index: | 1.533 |
| Water Solubility: | Soluble in Water, Methanol and Toluene. |
| Solubility: | Soluble in Water, Methanol and Toluene. |
| Appearance: | Pale yellow to yellow colour liquid. |
| Storage Temperature: | Store in a cool, dry place. Keep container closed when not in use. |
| Safety Data |
| Hazard Symbols |
Xi:Irritant
|
| |
 |
