| Identification |
| Name: | Cyclohexanecarboxylicacid, 4-propyl-, trans- |
| Synonyms: | 4-trans-Propyl-1-cyclohexanecarboxylicacid;trans-4-Propylcyclohexane-1-carboxylic acid;trans-4-n-Propylcyclohexanecarboxylic acid; |
| CAS: | 38289-27-9 |
| Molecular Formula: | C10H18O2 |
| Molecular Weight: | 170.25 |
| InChI: | InChI=1/C10H18O2/c1-2-3-8-4-6-9(7-5-8)10(11)12/h8-9H,2-7H2,1H3,(H,11,12)/t8-,9- |
| Molecular Structure: |
 |
| Properties |
| Melting Point: | 93°C |
| Flash Point: | 129.5°C |
| Boiling Point: | 270.3°C at 760 mmHg |
| Density: | 0.985g/cm3 |
| Refractive index: | 1.464 |
| Appearance: | white to light yellow crystal powder |
| Flash Point: | 129.5°C |
| Usage: | Intermediates of Liquid Crystals |
| Safety Data |
| |
 |
