| Identification | |
| Name: | N'-Nitrosopentyl-(2-picolyl)amine |
| CAS: | 383417-48-9 |
| Molecular Formula: | C11H17N3O |
| Molecular Weight: | 207.275 |
| InChI: | InChI=1/C11H17N3O/c1-2-3-6-9-14(13-15)10-11-7-4-5-8-12-11/h4-5,7-8H,2-3,6,9-10H2,1H3 |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 172.1°C |
| Boiling Point: | 361°C at 760 mmHg |
| Density: | 1.04g/cm3 |
| Refractive index: | 1.533 |
| Flash Point: | 172.1°C |
| Usage: | N?Nitrosopentylpicolyamine can be used as an internal standard for the determination of tobacco-specific nitrosamines using gas chromatography in combination with chemiluminescence detection. |
| Safety Data | |
 |
|
