| Identification | |
| Name: | 1,1'-Biphenyl,2,3',4'-trichloro- |
| Synonyms: | Biphenyl,2',3,4-trichloro- (6CI); 2,3',4'-Trichlorobiphenyl;2',3,4-Trichloro-1,1'-biphenyl; 2',3,4-Trichlorobiphenyl; 3,4,2'-Trichlorobiphenyl;PCB 33 |
| CAS: | 38444-86-9 |
| EINECS: | 215-648-1 |
| Molecular Formula: | C12H7 Cl3 |
| Molecular Weight: | 257.54 |
| InChI: | InChI=1/C12H7Cl3/c13-10-4-2-1-3-9(10)8-5-6-11(14)12(15)7-8/h1-7H |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN 3432 9 |
| Density: | 1.351 g/cm3 |
| Refractive index: | 1.603 |
| Specification: |
2,3',4'-Trichlorobiphenyl ,its cas register number is 38444-86-9. It also can be called 2,3',4'-Trichloro-1,1'-biphenyl ; Biphenyl, 2',3,4-trichloro- ;and 1,1'-Biphenyl, 2',3,4-trichloro- . |
| Safety Data | |
| Hazard Symbols |
N: Dangerous for the environment
|
 |
|
