| Identification | |
| Name: | 2-Propenamide,N-[3-(dimethylamino)propyl]- |
| Synonyms: | Acrylamide,N-[3-(dimethylamino)propyl]- (6CI,7CI,8CI);3-(N,N-Dimethylaminopropyl)acrylamide; Acrylamidopropyldimethylamine;Dimethyl(3-acrylamidopropyl)amine; N-[3-(Dimethylamino)propyl]acrylamide;[3-(Acryloylamino)propyl]dimethylamine |
| CAS: | 3845-76-9 |
| EINECS: | 223-342-4 |
| Molecular Formula: | C8H16 N2 O |
| Molecular Weight: | 156.22544 |
| InChI: | InChI=1S/C8H16N2O/c1-4-8(11)9-6-5-7-10(2)3/h4H,1,5-7H2,2-3H3,(H,9,11) |
| Molecular Structure: | ![(C8H16N2O) Acrylamide,N-[3-(dimethylamino)propyl]- (6CI,7CI,8CI);3-(N,N-Dimethylaminopropyl)acrylamide; Acrylam...](https://img1.guidechem.com/chem/e/dict/35/3845-76-9.jpg) |
| Properties | |
| Transport: | UN 1993 3 |
| Melting Point: | -37ºC |
| Flash Point: | 127.8ºC |
| Density: | 0.80 g/mL at 20ºC |
| Refractive index: | 1.459 |
| Water Solubility: | soluable in water and Most organic solvents |
| Solubility: | soluable in water and Most organic solvents |
| Appearance: | Light yellow oil liquid |
| Specification: |
N,N-Dimethylaminopropyl acrylamide , its cas register number is 3845-76-9. It also can be called 2-Propenamide,N-[3-(dimethylamino)propyl]- ; N-[3-(Dimethylamino)propyl]acrylamide . |
| Flash Point: | 127.8ºC |
| Storage Temperature: | 2-8°C |
| Safety Data | |
| Hazard Symbols |
Xi: Irritant
|
 |
|
