| Identification | |
| Name: | Disperse Blue 26 |
| Synonyms: | Anthraquinone,1,5-dihydroxy-4,8-bis(methylamino)- (6CI,7CI,8CI);C.I. 63305;C.I. DisperseBlue 26;Dipersol Blue B-G;9,10-Anthracenedione,1,5-dihydroxy-4,8-bis(methylamino)-;Dispersol Blue B-G;Duranol BlueG;Duranol Printing Blue G;Kayalon Polyester Blue GF;Navilene Blue GL;PTB31;RTB 31;Resiren Blue TG;Serilene Blue 2GL;Serilene Blue GL;SumikaronBlue BR;Sumikaron Blue E-BR; |
| CAS: | 3860-63-7 |
| EINECS: | 223-373-3 |
| Molecular Formula: | C16H14N2O4 |
| Molecular Weight: | 298.29336 |
| InChI: | InChI=1S/C16H14N2O4/c1-17-7-3-5-9(19)13-11(7)15(21)14-10(20)6-4-8(18-2)12(14)16(13)22/h3-6,17-20H,1-2H3 |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 325.3 °C |
| Boiling Point: | 614.3 °C at 760mmHg |
| Density: | 1.53 g/cm3 |
| Refractive index: | 1.778 |
| Water Solubility: | soluble in acetone, ethanol and benzene |
| Solubility: | soluble in acetone, ethanol and benzene |
| Appearance: | navy blue powder |
| Specification: |
Disperse Blue 26 (CAS NO.3860-63-7) is also named as 1,5-dihydroxy-4,8-bis(methylamino)-10-anthracenedione ; 10-Anthracenedione,1,5-dihydroxy-4,8-bis(methylamino)-9 ; 1,5-dihydroxy-4,8-bis(methylamino)anthraquinone ; C.I.63305 ; Disperse blue 26 (C.I. 63305) ; 9, 10-Anthracenedione, 1, 5-dihydroxy-4, 8-bis(methylamino) . Disperse Blue 26 (CAS NO.3860-63-7) is navy blue powder. It is soluble in acetone, ethanol and benzene. |
| Flash Point: | 325.3 °C |
| Safety Data | |
 |
|
